Products 193945-44-7
CAS 193945-44-7 is the registry number for 1,3-Propane-1,1,3,3-d4-diamine 2HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1,1,3,3-tetradeuteriopropane-1,3-diamine;dihydrochloride (CAS 193945-44-7) is a chemical compound with the molecular formula C3H12Cl2N2 and a molecular weight of 151.07 g/mol. IUPAC name: 1,1,3,3-tetradeuteriopropane-1,3-diamine;dihydrochloride. InChIKey: HYOCSVGEQMCOGE-SNSYAXNKSA-N.
| Molecular formula | C3H12Cl2N2 |
|---|---|
| Molecular weight | 151.07 g/mol |
| IUPAC name | 1,1,3,3-tetradeuteriopropane-1,3-diamine;dihydrochloride |
| InChIKey | HYOCSVGEQMCOGE-SNSYAXNKSA-N |
| SMILES | [2H]C([2H])(CC([2H])([2H])N)N.Cl.Cl |
Computed by PubChem (NCBI)