Products 65898-86-4
CAS 65898-86-4 is the registry number for 1,3-Propane-d6-diamine 2HCl, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,1,2,2,3,3-hexadeuteriopropane-1,3-diamine;dihydrochloride (CAS 65898-86-4) is a chemical compound with the molecular formula C3H12Cl2N2 and a molecular weight of 153.08 g/mol. IUPAC name: 1,1,2,2,3,3-hexadeuteriopropane-1,3-diamine;dihydrochloride. InChIKey: HYOCSVGEQMCOGE-HRTLFCCJSA-N.
| Molecular formula | C3H12Cl2N2 |
|---|---|
| Molecular weight | 153.08 g/mol |
| IUPAC name | 1,1,2,2,3,3-hexadeuteriopropane-1,3-diamine;dihydrochloride |
| InChIKey | HYOCSVGEQMCOGE-HRTLFCCJSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)C([2H])([2H])N.Cl.Cl |
Computed by PubChem (NCBI)