Products 352438-79-0

CAS 352438-79-0 is the registry number for 1,3-Propane-2,2-d2-diamine 2HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

2,2-dideuteriopropane-1,3-diamine;dihydrochloride (CAS 352438-79-0) is a chemical compound with the molecular formula C3H12Cl2N2 and a molecular weight of 149.06 g/mol. IUPAC name: 2,2-dideuteriopropane-1,3-diamine;dihydrochloride. InChIKey: HYOCSVGEQMCOGE-SRTIKVJZSA-N.

Identity
Molecular formulaC3H12Cl2N2
Molecular weight149.06 g/mol
IUPAC name2,2-dideuteriopropane-1,3-diamine;dihydrochloride
InChIKeyHYOCSVGEQMCOGE-SRTIKVJZSA-N
SMILES[2H]C([2H])(CN)CN.Cl.Cl

Computed by PubChem (NCBI)