CAS 19397-28-5 appears in our catalog under these names: Cedrelopsin, 98+%, Cedrelopsin. Offered by: AmBeed, Biosynth, MedChemExpress. Available pack sizes: 5mg, 50mg, 0,5g, Get quote.
7-hydroxy-6-methoxy-8-(3-methylbut-2-enyl)chromen-2-one (CAS 19397-28-5) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 7-hydroxy-6-methoxy-8-(3-methylbut-2-enyl)chromen-2-one. InChIKey: IIEIJMSDKBAFFP-UHFFFAOYSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 7-hydroxy-6-methoxy-8-(3-methylbut-2-enyl)chromen-2-one |
| InChIKey | IIEIJMSDKBAFFP-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=CC(=C1O)OC)C=CC(=O)O2)C |
Computed by PubChem (NCBI)