Products 1942059-22-4
CAS 1942059-22-4 is the registry number for Methyl (2S,3S,4R,5R)-6-ethynyl-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S,4R,5R)-6-ethynyl-3,4,5-trihydroxyoxane-2-carboxylate (CAS 1942059-22-4) is a chemical compound with the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. IUPAC name: methyl (2S,3S,4R,5R)-6-ethynyl-3,4,5-trihydroxyoxane-2-carboxylate. InChIKey: UFILMOXYHNVSHW-UKKBYBOISA-N.
| Molecular formula | C9H12O6 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | methyl (2S,3S,4R,5R)-6-ethynyl-3,4,5-trihydroxyoxane-2-carboxylate |
| InChIKey | UFILMOXYHNVSHW-UKKBYBOISA-N |
| SMILES | COC(=O)[C@@H]1[C@H]([C@@H]([C@H](C(O1)C#C)O)O)O |
Computed by PubChem (NCBI)