CAS 19430-83-2 appears in our catalog under these names: 3,4'-Methylenedianiline, 98%, 3-(4-Aminobenzyl)aniline, 98%, 3,4'-Diaminodiphenylmethane, >98.0%(GC)(T), 3-(4-Aminobenzyl)aniline. Offered by: Combi-blocks, AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
3-[(4-aminophenyl)methyl]aniline (CAS 19430-83-2) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 3-[(4-aminophenyl)methyl]aniline. InChIKey: FGWQCROGAHMWSU-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 3-[(4-aminophenyl)methyl]aniline |
| InChIKey | FGWQCROGAHMWSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)CC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)