CAS 19435-27-9 is the registry number for 5-(Acetylamino)-3-(1-methylethyl)-1,2,3-oxadiazolium, inner salt, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate (CAS 19435-27-9) is a chemical compound with the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. IUPAC name: N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate. InChIKey: FCCKOSKYTIDTLE-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O2 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | N-(3-propan-2-yloxadiazol-3-ium-5-yl)ethanimidate |
| InChIKey | FCCKOSKYTIDTLE-UHFFFAOYSA-N |
| SMILES | CC(C)[N+]1=NOC(=C1)N=C(C)[O-] |
Computed by PubChem (NCBI)