CAS 194490-18-1 appears in our catalog under these names: ethyl 5-tert-butyl-1H-indole-2-carboxylate, 95%, 95%, 5-TERT-BUTYL-1H-INDOLE-2-CARBOXYLIC ACID ETHYL ESTER, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Ethyl 5-tert-butyl-1H-indole-2-carboxylate (CAS 194490-18-1) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: ethyl 5-tert-butyl-1H-indole-2-carboxylate. InChIKey: ULMVLLISCAWCMZ-UHFFFAOYSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | ethyl 5-tert-butyl-1H-indole-2-carboxylate |
| InChIKey | ULMVLLISCAWCMZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(C)(C)C |
Computed by PubChem (NCBI)