Products 1946010-93-0
CAS 1946010-93-0 appears in our catalog under these names: (R)–3–(Methylsulfonyl)piperidine hydrochloride, (R)-3-(Methylsulfonyl)piperidine hydrochloride 97%, (R)-3-(Methylsulfonyl)piperidine hydrochloride, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
(3R)-3-methylsulfonylpiperidine;hydrochloride (CAS 1946010-93-0) is a chemical compound with the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. IUPAC name: (3R)-3-methylsulfonylpiperidine;hydrochloride. InChIKey: MRLKRLRBGARQIK-FYZOBXCZSA-N.
| Molecular formula | C6H14ClNO2S |
|---|---|
| Molecular weight | 199.70 g/mol |
| IUPAC name | (3R)-3-methylsulfonylpiperidine;hydrochloride |
| InChIKey | MRLKRLRBGARQIK-FYZOBXCZSA-N |
| SMILES | CS(=O)(=O)[C@@H]1CCCNC1.Cl |
Computed by PubChem (NCBI)