CAS 1946021-29-9 is the registry number for 6-Chloro-3,3-dimethyl-2,3-dihydro-1H-pyrrolo(2,3-b)pyridine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 10g.
6-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-b]pyridine;hydrochloride (CAS 1946021-29-9) is a chemical compound with the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. IUPAC name: 6-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-b]pyridine;hydrochloride. InChIKey: SELVWELJYUBLOE-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | 6-chloro-3,3-dimethyl-1,2-dihydropyrrolo[2,3-b]pyridine;hydrochloride |
| InChIKey | SELVWELJYUBLOE-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1C=CC(=N2)Cl)C.Cl |
Computed by PubChem (NCBI)