CAS 53423-60-2 is the registry number for [Chloro(phenylimino)methyl]dimethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N,N-dimethyl-N'-phenylcarbamimidoyl chloride;hydrochloride (CAS 53423-60-2) is a chemical compound with the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. IUPAC name: N,N-dimethyl-N'-phenylcarbamimidoyl chloride;hydrochloride. InChIKey: ORUDJALVLGLNMX-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | N,N-dimethyl-N'-phenylcarbamimidoyl chloride;hydrochloride |
| InChIKey | ORUDJALVLGLNMX-UHFFFAOYSA-N |
| SMILES | CN(C)C(=NC1=CC=CC=C1)Cl.Cl |
Computed by PubChem (NCBI)