Products 53423-60-2

CAS 53423-60-2 is the registry number for [Chloro(phenylimino)methyl]dimethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

N,N-dimethyl-N'-phenylcarbamimidoyl chloride;hydrochloride (CAS 53423-60-2) is a chemical compound with the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. IUPAC name: N,N-dimethyl-N'-phenylcarbamimidoyl chloride;hydrochloride. InChIKey: ORUDJALVLGLNMX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12Cl2N2
Molecular weight219.11 g/mol
IUPAC nameN,N-dimethyl-N'-phenylcarbamimidoyl chloride;hydrochloride
InChIKeyORUDJALVLGLNMX-UHFFFAOYSA-N
SMILESCN(C)C(=NC1=CC=CC=C1)Cl.Cl

Computed by PubChem (NCBI)