CAS 2197055-11-9 is the registry number for (5-Chloropyridin-2-yl)(cyclopropyl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(5-chloro-2-pyridinyl)-cyclopropylmethanamine;hydrochloride (CAS 2197055-11-9) is a chemical compound with the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. IUPAC name: (5-chloro-2-pyridinyl)-cyclopropylmethanamine;hydrochloride. InChIKey: PDDNCFNQDFOEKW-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2 |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | (5-chloro-2-pyridinyl)-cyclopropylmethanamine;hydrochloride |
| InChIKey | PDDNCFNQDFOEKW-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=NC=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)