Products 19462-08-9
CAS 19462-08-9 is the registry number for (R)-4-(2-Amino-1-hydroxyethyl)phenol Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
4-[(1R)-2-amino-1-hydroxyethyl]phenol;hydrochloride (CAS 19462-08-9) is a chemical compound with the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. IUPAC name: 4-[(1R)-2-amino-1-hydroxyethyl]phenol;hydrochloride. InChIKey: PUMZXCBVHLCWQG-QRPNPIFTSA-N.
| Molecular formula | C8H12ClNO2 |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 4-[(1R)-2-amino-1-hydroxyethyl]phenol;hydrochloride |
| InChIKey | PUMZXCBVHLCWQG-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CN)O)O.Cl |
Computed by PubChem (NCBI)