CAS 1948234-39-6 is the registry number for 3-Fluoro-5-(5-methylthiazol-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-5-(5-methyl-1,3-thiazol-2-yl)benzonitrile (CAS 1948234-39-6) is a chemical compound with the molecular formula C11H7FN2S and a molecular weight of 218.25 g/mol. IUPAC name: 3-fluoro-5-(5-methyl-1,3-thiazol-2-yl)benzonitrile. InChIKey: QHMBLOUNDIXROP-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 3-fluoro-5-(5-methyl-1,3-thiazol-2-yl)benzonitrile |
| InChIKey | QHMBLOUNDIXROP-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)C2=CC(=CC(=C2)C#N)F |
Computed by PubChem (NCBI)