CAS 7025-29-8 is the registry number for 6-(4-Fluoro-phenyl)-imidazo2,1-bthiazole. Offered by: Biosynth. Available pack sizes: 10g, 1g.
6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole (CAS 7025-29-8) is a chemical compound with the molecular formula C11H7FN2S and a molecular weight of 218.25 g/mol. IUPAC name: 6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole. InChIKey: MLJMNXPHZZTCAX-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazole |
| InChIKey | MLJMNXPHZZTCAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C=CSC3=N2)F |
Computed by PubChem (NCBI)