CAS 342405-40-7 is the registry number for 2-[4-(4-Fluorophenyl)-1,3-thiazol-2-yl]acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetonitrile (CAS 342405-40-7) is a chemical compound with the molecular formula C11H7FN2S and a molecular weight of 218.25 g/mol. IUPAC name: 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetonitrile. InChIKey: NZAVIOLUOHTQTC-UHFFFAOYSA-N.
| Molecular formula | C11H7FN2S |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetonitrile |
| InChIKey | NZAVIOLUOHTQTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)CC#N)F |
Computed by PubChem (NCBI)