CAS 792936-51-7 is the registry number for 3-Fluoro-4-methoxy-5-nitrobenzyl alcohol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-fluoro-4-methoxy-5-nitrophenyl)methanol (CAS 792936-51-7) is a chemical compound with the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. IUPAC name: (3-fluoro-4-methoxy-5-nitrophenyl)methanol. InChIKey: JCMXBJANPKBLLO-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | (3-fluoro-4-methoxy-5-nitrophenyl)methanol |
| InChIKey | JCMXBJANPKBLLO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1F)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)