CAS 959081-93-7 is the registry number for 1-Fluoro-4,5-dimethoxy-2-nitrobenzene, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
1-fluoro-4,5-dimethoxy-2-nitrobenzene (CAS 959081-93-7) is a chemical compound with the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. IUPAC name: 1-fluoro-4,5-dimethoxy-2-nitrobenzene. InChIKey: BUMDYIAERBGUID-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 1-fluoro-4,5-dimethoxy-2-nitrobenzene |
| InChIKey | BUMDYIAERBGUID-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])F)OC |
Computed by PubChem (NCBI)