Products 1951371-91-7
CAS 1951371-91-7 is the registry number for tert-Butyl (3S,4S)-3-amino-4-(4-fluorophenoxy)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3S,4S)-3-amino-4-(4-fluorophenoxy)pyrrolidine-1-carboxylate (CAS 1951371-91-7) is a chemical compound with the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. IUPAC name: tert-butyl (3S,4S)-3-amino-4-(4-fluorophenoxy)pyrrolidine-1-carboxylate. InChIKey: KMTCLPACNLRSEN-STQMWFEESA-N.
| Molecular formula | C15H21FN2O3 |
|---|---|
| Molecular weight | 296.34 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-amino-4-(4-fluorophenoxy)pyrrolidine-1-carboxylate |
| InChIKey | KMTCLPACNLRSEN-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)OC2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)