Products 952680-48-7

CAS 952680-48-7 is the registry number for Linezolid Impurity 35. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate (CAS 952680-48-7) is a chemical compound with the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. IUPAC name: tert-butyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate. InChIKey: QIFHUGWYHCWZAP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21FN2O3
Molecular weight296.34 g/mol
IUPAC nametert-butyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate
InChIKeyQIFHUGWYHCWZAP-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC(=C(C=C1)N2CCOCC2)F

Computed by PubChem (NCBI)