Products 2230200-31-2
CAS 2230200-31-2 is the registry number for tert-Butyl 4-(5-fluoro-6-oxo-1,6-dihydropyridin-2-yl)piperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(5-fluoro-6-oxo-1H-pyridin-2-yl)piperidine-1-carboxylate (CAS 2230200-31-2) is a chemical compound with the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. IUPAC name: tert-butyl 4-(5-fluoro-6-oxo-1H-pyridin-2-yl)piperidine-1-carboxylate. InChIKey: POYYHAMDUVMQJH-UHFFFAOYSA-N.
| Molecular formula | C15H21FN2O3 |
|---|---|
| Molecular weight | 296.34 g/mol |
| IUPAC name | tert-butyl 4-(5-fluoro-6-oxo-1H-pyridin-2-yl)piperidine-1-carboxylate |
| InChIKey | POYYHAMDUVMQJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=C(C(=O)N2)F |
Computed by PubChem (NCBI)