CAS 1951442-10-6 appears in our catalog under these names: 4-(Piperazin-1-ylmethyl)phenol dihydrochloride, 97%, 4-((Piperazin-1-yl)methyl)phenol dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1000mg, 5000mg.
4-(piperazin-1-ylmethyl)phenol;dihydrochloride (CAS 1951442-10-6) is a chemical compound with the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. IUPAC name: 4-(piperazin-1-ylmethyl)phenol;dihydrochloride. InChIKey: MJXZQJYHXUYDDC-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2O |
|---|---|
| Molecular weight | 265.18 g/mol |
| IUPAC name | 4-(piperazin-1-ylmethyl)phenol;dihydrochloride |
| InChIKey | MJXZQJYHXUYDDC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC=C(C=C2)O.Cl.Cl |
Computed by PubChem (NCBI)