Products 1952261-87-8
CAS 1952261-87-8 is the registry number for EP3 antagonist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3R)-3-methyl-2-oxopiperidin-3-yl]-6-(5-methylquinolin-3-yl)-1H-pyridin-2-one (CAS 1952261-87-8) is a chemical compound with the molecular formula C21H21N3O2 and a molecular weight of 347.4 g/mol. IUPAC name: 3-[(3R)-3-methyl-2-oxopiperidin-3-yl]-6-(5-methylquinolin-3-yl)-1H-pyridin-2-one. InChIKey: OJVNYQOKTZLPPX-OAQYLSRUSA-N.
| Molecular formula | C21H21N3O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 3-[(3R)-3-methyl-2-oxopiperidin-3-yl]-6-(5-methylquinolin-3-yl)-1H-pyridin-2-one |
| InChIKey | OJVNYQOKTZLPPX-OAQYLSRUSA-N |
| SMILES | CC1=C2C=C(C=NC2=CC=C1)C3=CC=C(C(=O)N3)[C@]4(CCCNC4=O)C |
Computed by PubChem (NCBI)