CAS 195372-65-7 is the registry number for N-(2-Bromo-4-chlorophenyl)-2,2-dimethylpropanamide. Offered by: Biosynth. Available pack sizes: 1g, 5g.
N-(2-bromo-4-chlorophenyl)-2,2-dimethylpropanamide (CAS 195372-65-7) is a chemical compound with the molecular formula C11H13BrClNO and a molecular weight of 290.58 g/mol. IUPAC name: N-(2-bromo-4-chlorophenyl)-2,2-dimethylpropanamide. InChIKey: YQZVDKHNBCIHCR-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO |
|---|---|
| Molecular weight | 290.58 g/mol |
| IUPAC name | N-(2-bromo-4-chlorophenyl)-2,2-dimethylpropanamide |
| InChIKey | YQZVDKHNBCIHCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)