Products 1954756-80-9
CAS 1954756-80-9 is the registry number for 3-(2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetamido)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoic acid (CAS 1954756-80-9) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: 3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoic acid. InChIKey: PXNSIRHNTLHRQS-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 3-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]propanoic acid |
| InChIKey | PXNSIRHNTLHRQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CC(=O)NCCC(=O)O |
Computed by PubChem (NCBI)