Products 1955473-67-2
CAS 1955473-67-2 is the registry number for Methyl (2S,3R)-2-(cyclopropylamino)-3-hydroxybutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (2S,3R)-2-(cyclopropylamino)-3-hydroxybutanoate;hydrochloride (CAS 1955473-67-2) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl (2S,3R)-2-(cyclopropylamino)-3-hydroxybutanoate;hydrochloride. InChIKey: WCRYVLPZSRADTC-PACXSXMQSA-N.
| Molecular formula | C8H16ClNO3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | methyl (2S,3R)-2-(cyclopropylamino)-3-hydroxybutanoate;hydrochloride |
| InChIKey | WCRYVLPZSRADTC-PACXSXMQSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC1CC1)O.Cl |
Computed by PubChem (NCBI)