CAS 1955492-59-7 is the registry number for 3-(Fluorosulfonyl)-4,5-dimethylbenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-fluorosulfonyl-4,5-dimethylbenzoic acid (CAS 1955492-59-7) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: 3-fluorosulfonyl-4,5-dimethylbenzoic acid. InChIKey: UUWWTLKWWPWKIK-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 3-fluorosulfonyl-4,5-dimethylbenzoic acid |
| InChIKey | UUWWTLKWWPWKIK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)S(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)