Products 1955493-87-4
CAS 1955493-87-4 is the registry number for rac-(2R,3R)-2-phenyloxane-3-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2R,3R)-2-phenyloxane-3-carboxylic acid (CAS 1955493-87-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: (2R,3R)-2-phenyloxane-3-carboxylic acid. InChIKey: PLTXACXZZGZCLU-MNOVXSKESA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | (2R,3R)-2-phenyloxane-3-carboxylic acid |
| InChIKey | PLTXACXZZGZCLU-MNOVXSKESA-N |
| SMILES | C1C[C@H]([C@@H](OC1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
rac-(2R,3R)-2-phenyloxane-3-carboxylic acid, rac-(2R,3R)-2-phenyloxane-3-carboxylic acid, trans, (2R,3R)-2-Phenyloxane-3-carboxylic acid, (2R,3R)-2-Phenyltetrahydro-2H-pyran-3-carboxylic acid, rel-(2R,3R)-Tetrahydro-2-phenyl-2H-pyran-3-carboxylic acid, 2H-Pyran-3-carboxylic acid, tetrahydro-2-phenyl-, (2R,3R)-rel-