Products 1955497-88-7
CAS 1955497-88-7 is the registry number for 3-(tert-Butoxy)-2-methoxy-2-methyl-3-oxopropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid (CAS 1955497-88-7) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: 2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid. InChIKey: VKEXGIHUNWGURM-UHFFFAOYSA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 2-methoxy-2-methyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid |
| InChIKey | VKEXGIHUNWGURM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C)(C(=O)O)OC |
Computed by PubChem (NCBI)