Products 1955499-65-6
CAS 1955499-65-6 is the registry number for 5-{((Naphthalen-1-yl)methyl)amino}-2-phenyl-1,3-oxazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(naphthalen-1-ylmethylamino)-2-phenyl-1,3-oxazole-4-carbonitrile (CAS 1955499-65-6) is a chemical compound with the molecular formula C21H15N3O and a molecular weight of 325.4 g/mol. IUPAC name: 5-(naphthalen-1-ylmethylamino)-2-phenyl-1,3-oxazole-4-carbonitrile. InChIKey: OWDSWQLJOWBJPT-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 5-(naphthalen-1-ylmethylamino)-2-phenyl-1,3-oxazole-4-carbonitrile |
| InChIKey | OWDSWQLJOWBJPT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)NCC3=CC=CC4=CC=CC=C43)C#N |
Computed by PubChem (NCBI)