CAS 284483-10-9 appears in our catalog under these names: (R)-2-(1,10-Phenanthrolin-2-yl)-4-phenyl-4,5-dihydrooxazole, 98%, 98%, (R)-2-(1,10-Phenanthrolin-2-yl)-4-phenyl-4,5-dihydrooxazole, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4R)-2-(1,10-phenanthrolin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 284483-10-9) is a chemical compound with the molecular formula C21H15N3O and a molecular weight of 325.4 g/mol. IUPAC name: (4R)-2-(1,10-phenanthrolin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: MVTKJCWVOKAUOU-SFHVURJKSA-N.
| Molecular formula | C21H15N3O |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (4R)-2-(1,10-phenanthrolin-2-yl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | MVTKJCWVOKAUOU-SFHVURJKSA-N |
| SMILES | C1[C@H](N=C(O1)C2=NC3=C(C=CC4=C3N=CC=C4)C=C2)C5=CC=CC=C5 |
Computed by PubChem (NCBI)