CAS 3202-86-6 is the registry number for 2-(4,6-Diphenyl-1,3,5-triazin-2-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenol (CAS 3202-86-6) is a chemical compound with the molecular formula C21H15N3O and a molecular weight of 325.4 g/mol. IUPAC name: 2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenol. InChIKey: FRSMLANYBOTORN-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenol |
| InChIKey | FRSMLANYBOTORN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=CC=C3O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)