Products 1955499-67-8
CAS 1955499-67-8 is the registry number for 1-tert-Butyl-6-chloro-4-methoxy-1H-pyrazolo(3,4-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-tert-butyl-6-chloro-4-methoxypyrazolo[5,4-d]pyrimidine (CAS 1955499-67-8) is a chemical compound with the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. IUPAC name: 1-tert-butyl-6-chloro-4-methoxypyrazolo[5,4-d]pyrimidine. InChIKey: REHKFMRUFSAGIH-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4O |
|---|---|
| Molecular weight | 240.69 g/mol |
| IUPAC name | 1-tert-butyl-6-chloro-4-methoxypyrazolo[5,4-d]pyrimidine |
| InChIKey | REHKFMRUFSAGIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=NC(=N2)Cl)OC |
Computed by PubChem (NCBI)