CAS 1955505-76-6 is the registry number for rac-(3R,5S)-5-Fluoropiperidin-3-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,5R)-5-fluoropiperidin-3-ol;hydrochloride (CAS 1955505-76-6) is a chemical compound with the molecular formula C5H11ClFNO and a molecular weight of 155.60 g/mol. IUPAC name: (3S,5R)-5-fluoropiperidin-3-ol;hydrochloride. InChIKey: QMKBDNDYFMTBHH-JBUOLDKXSA-N.
| Molecular formula | C5H11ClFNO |
|---|---|
| Molecular weight | 155.60 g/mol |
| IUPAC name | (3S,5R)-5-fluoropiperidin-3-ol;hydrochloride |
| InChIKey | QMKBDNDYFMTBHH-JBUOLDKXSA-N |
| SMILES | C1[C@@H](CNC[C@@H]1F)O.Cl |
Computed by PubChem (NCBI)