CAS 1955506-71-4 is the registry number for 3-(Oxan-4-yl)-(1,2)oxazolo(5,4-b)pyridine-5-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(oxan-4-yl)-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1955506-71-4) is a chemical compound with the molecular formula C11H11ClN2O4S and a molecular weight of 302.73 g/mol. IUPAC name: 3-(oxan-4-yl)-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: BDIARBSGLJBGPC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O4S |
|---|---|
| Molecular weight | 302.73 g/mol |
| IUPAC name | 3-(oxan-4-yl)-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | BDIARBSGLJBGPC-UHFFFAOYSA-N |
| SMILES | C1COCCC1C2=NOC3=C2C=C(C=N3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)