CAS 6387-17-3 is the registry number for 3-Chloro-5-methyl-4-(3-methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5-methyl-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid (CAS 6387-17-3) is a chemical compound with the molecular formula C11H11ClN2O4S and a molecular weight of 302.73 g/mol. IUPAC name: 3-chloro-5-methyl-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid. InChIKey: QENFKLWBWWDGLL-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O4S |
|---|---|
| Molecular weight | 302.73 g/mol |
| IUPAC name | 3-chloro-5-methyl-4-(3-methyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid |
| InChIKey | QENFKLWBWWDGLL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=C(C=C(C=C2C)S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)