CAS 591212-93-0 is the registry number for 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]ethyl chloroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-chloroacetate (CAS 591212-93-0) is a chemical compound with the molecular formula C11H11ClN2O4S and a molecular weight of 302.73 g/mol. IUPAC name: 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-chloroacetate. InChIKey: TVLHLHJZWXRACF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O4S |
|---|---|
| Molecular weight | 302.73 g/mol |
| IUPAC name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 2-chloroacetate |
| InChIKey | TVLHLHJZWXRACF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NCCOC(=O)CCl)NS2(=O)=O |
Computed by PubChem (NCBI)