CAS 1955518-15-6 is the registry number for 6-(2-Bromo-4-methylphenoxy)-1,5-dihydroquinolin-5-imine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2-bromo-4-methylphenoxy)quinolin-5-amine (CAS 1955518-15-6) is a chemical compound with the molecular formula C16H13BrN2O and a molecular weight of 329.19 g/mol. IUPAC name: 6-(2-bromo-4-methylphenoxy)quinolin-5-amine. InChIKey: USIPZFOOFUWYDM-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2O |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | 6-(2-bromo-4-methylphenoxy)quinolin-5-amine |
| InChIKey | USIPZFOOFUWYDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=C(C3=C(C=C2)N=CC=C3)N)Br |
Computed by PubChem (NCBI)