CAS 2860499-50-7 appears in our catalog under these names: 5-Bromo-N-methyl-N-phenyl-1H-indole-2-carboxamide 95%, 5-Bromo-N-methyl-N-phenyl-1H-indole-2-carboxamide, ≥95%, ≥95%, 5-Bromo-N-methyl-N-phenyl-1H-indole-2-carboxamide, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
5-bromo-N-methyl-N-phenyl-1H-indole-2-carboxamide (CAS 2860499-50-7) is a chemical compound with the molecular formula C16H13BrN2O and a molecular weight of 329.19 g/mol. IUPAC name: 5-bromo-N-methyl-N-phenyl-1H-indole-2-carboxamide. InChIKey: WXMRDRVSIGFNOS-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2O |
|---|---|
| Molecular weight | 329.19 g/mol |
| IUPAC name | 5-bromo-N-methyl-N-phenyl-1H-indole-2-carboxamide |
| InChIKey | WXMRDRVSIGFNOS-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C(=O)C2=CC3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)