CAS 1955524-08-9 appears in our catalog under these names: Ethyl 2-(2-bromo-5-methylthiazol-4-yl)acetate, 98%, Ethyl 2-(2-bromo-5-methyl-1,3-thiazol-4-yl)acetate. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
Ethyl 2-(2-bromo-5-methyl-1,3-thiazol-4-yl)acetate (CAS 1955524-08-9) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: ethyl 2-(2-bromo-5-methyl-1,3-thiazol-4-yl)acetate. InChIKey: XVMVXJBBUWTRJC-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | ethyl 2-(2-bromo-5-methyl-1,3-thiazol-4-yl)acetate |
| InChIKey | XVMVXJBBUWTRJC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(SC(=N1)Br)C |
Computed by PubChem (NCBI)