CAS 1955530-22-9 is the registry number for {5H,6H,7H-Cyclopenta(b)pyridin-7-yl}methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylmethanamine;dihydrochloride (CAS 1955530-22-9) is a chemical compound with the molecular formula C9H14Cl2N2 and a molecular weight of 221.12 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylmethanamine;dihydrochloride. InChIKey: NYEYZTSONPSJDK-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2 |
|---|---|
| Molecular weight | 221.12 g/mol |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[b]pyridin-7-ylmethanamine;dihydrochloride |
| InChIKey | NYEYZTSONPSJDK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CN)N=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)