Products 1955539-90-8
CAS 1955539-90-8 appears in our catalog under these names: 2-Methyl-2-{(3-(trifluoromethyl)phenyl)methyl}pyrrolidine hydrochloride, 95%, 2-Methyl-2-{(3-(trifluoromethyl)phenyl)methyl}pyrrolidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;hydrochloride (CAS 1955539-90-8) is a chemical compound with the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. IUPAC name: 2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;hydrochloride. InChIKey: VDZSXKVDHZHNOY-UHFFFAOYSA-N.
| Molecular formula | C13H17ClF3N |
|---|---|
| Molecular weight | 279.73 g/mol |
| IUPAC name | 2-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine;hydrochloride |
| InChIKey | VDZSXKVDHZHNOY-UHFFFAOYSA-N |
| SMILES | CC1(CCCN1)CC2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)