Products 782504-66-9
CAS 782504-66-9 appears in our catalog under these names: 2-(3-Trifluoromethyl-benzyl)-piperidine hydrochloride, 95%, 2-(3-Trifluoromethyl-Benzyl)-Piperidine Hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 5g, 250mg, 1g, 500mg.
2-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride (CAS 782504-66-9) is a chemical compound with the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride. InChIKey: NHFRESSJJYDIME-UHFFFAOYSA-N.
| Molecular formula | C13H17ClF3N |
|---|---|
| Molecular weight | 279.73 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride |
| InChIKey | NHFRESSJJYDIME-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)CC2=CC(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)