CAS 2059935-66-7 is the registry number for 2,2-Dimethyl-3-(4-(trifluoromethyl)phenyl)pyrrolidine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 2059935-66-7) is a chemical compound with the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. IUPAC name: 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: FBYLFYOGGKAPOJ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClF3N |
|---|---|
| Molecular weight | 279.73 g/mol |
| IUPAC name | 2,2-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | FBYLFYOGGKAPOJ-UHFFFAOYSA-N |
| SMILES | CC1(C(CCN1)C2=CC=C(C=C2)C(F)(F)F)C.Cl |
Computed by PubChem (NCBI)