Products 1955547-92-8
CAS 1955547-92-8 appears in our catalog under these names: 2-(Hydroxymethyl)-1H-1,3-benzodiazole-4-carboxylic acid hydrochloride, 2-(Hydroxymethyl)-1H-benzo[d]imidazole-4-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
2-(hydroxymethyl)-1H-benzimidazole-4-carboxylic acid;hydrochloride (CAS 1955547-92-8) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: 2-(hydroxymethyl)-1H-benzimidazole-4-carboxylic acid;hydrochloride. InChIKey: KTADUJVIGWDHAV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 2-(hydroxymethyl)-1H-benzimidazole-4-carboxylic acid;hydrochloride |
| InChIKey | KTADUJVIGWDHAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=N2)CO)C(=O)O.Cl |
Computed by PubChem (NCBI)