CAS 1955553-77-1 is the registry number for 2-Methoxy-3,5-dimethylaniline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-methoxy-3,5-dimethylaniline;hydrochloride (CAS 1955553-77-1) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: 2-methoxy-3,5-dimethylaniline;hydrochloride. InChIKey: CPHPTXGXYDDGBL-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | 2-methoxy-3,5-dimethylaniline;hydrochloride |
| InChIKey | CPHPTXGXYDDGBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)N)OC)C.Cl |
Computed by PubChem (NCBI)