Products 1955558-04-9
CAS 1955558-04-9 is the registry number for (6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrochloride (CAS 1955558-04-9) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: (6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrochloride. InChIKey: WWNGXOBCLYJMKW-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | (6-fluoro-3,4-dihydro-2H-chromen-2-yl)methanamine;hydrochloride |
| InChIKey | WWNGXOBCLYJMKW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)OC1CN.Cl |
Computed by PubChem (NCBI)