Products 1955564-49-4
CAS 1955564-49-4 is the registry number for 1-{4-(1-(Hydroxyimino)ethyl)phenyl}pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]pyrrolidine-2,5-dione (CAS 1955564-49-4) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 1-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]pyrrolidine-2,5-dione. InChIKey: IWIZFKYKTAKHKQ-MDWZMJQESA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 1-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]pyrrolidine-2,5-dione |
| InChIKey | IWIZFKYKTAKHKQ-MDWZMJQESA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)N2C(=O)CCC2=O |
Computed by PubChem (NCBI)