Products 195604-40-1
CAS 195604-40-1 is the registry number for (S)-1-Cyclopropylethan-1-amine (2R,3R)-2,3-dihydroxysuccinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-cyclopropylethanamine;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 195604-40-1) is a chemical compound with the molecular formula C9H17NO6 and a molecular weight of 235.23 g/mol. IUPAC name: (1S)-1-cyclopropylethanamine;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: UXFIHKUWXRRSLF-PVVQJHSOSA-N.
| Molecular formula | C9H17NO6 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | (1S)-1-cyclopropylethanamine;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | UXFIHKUWXRRSLF-PVVQJHSOSA-N |
| SMILES | C[C@@H](C1CC1)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)