CAS 3055-46-7 is the registry number for Methyl 2-(acetylamino)-2-deoxy-D-glucopyranoside. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]acetamide (CAS 3055-46-7) is a chemical compound with the molecular formula C9H17NO6 and a molecular weight of 235.23 g/mol. IUPAC name: N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]acetamide. InChIKey: ZEVOCXOZYFLVKN-VARJHODCSA-N.
| Molecular formula | C9H17NO6 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | N-[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]acetamide |
| InChIKey | ZEVOCXOZYFLVKN-VARJHODCSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1OC)CO)O)O |
Computed by PubChem (NCBI)